కోబాల్ట్(II) క్లోరేట్

వికీపీడియా నుండి
Jump to navigation Jump to search
కోబాల్ట్(II) క్లోరేట్
Cobalt (II) chlorate.svg
గుర్తింపు విషయాలు
సి.ఎ.ఎస్. సంఖ్య
SMILES [Co+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O
ధర్మములు
Co(ClO3)2
మోలార్ ద్రవ్యరాశి 225.9 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☑Y verify (what is ☑Y☒N ?)
Infobox references





మూలాలు[మార్చు]