బేరియం క్లోరేట్

వికీపీడియా నుండి
Jump to navigation Jump to search
బేరియం క్లోరేట్
Barium chlorate.svg
IUPAC నామము
Barium dichlorate
ఇతర పేర్లు
Chloric acid, barium salt
గుర్తింపు విషయాలు
సి.ఎ.ఎస్. సంఖ్య [13477-00-4]
పబ్ కెమ్ 26059
ఆర్.టి.ఇ.సి.యస్. సంఖ్య FN9770000
SMILES [Ba+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O
మోలార్ ద్రవ్యరాశి 304.23 g/mol
స్వరూపం white solid
సాంద్రత 3.18 g/cm3, solid
ద్రవీభవన స్థానం 413.9 °C (777.0 °F; 687.0 K) (decomposes)
27.5 g/100 ml (20 °C)
ఇ.యు.వర్గీకరణ {{{value}}}
R-పదబంధాలు మూస:R9, మూస:R20/22
S-పదబంధాలు మూస:S13, మూస:S27
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☑Y verify (what is ☑Y☒N ?)
Infobox references

బేరియం క్లోరేట్ఒక రసాయన సమ్మేళన పదార్థం.ఇదిఒక అకర్బన సమ్మేళనం .


బేరియం, క్లోరిన్, ఆక్సిజన్ మూలకాల సమ్మేళనం /సంయోగం వలన బేరియం క్లోరేట్ ఏర్పడును.ఇది తెల్లని స్పటిక ఘనపదార్థం.ఇది క్లోరిక్ అమ్లంతో బేరియం రసాయనిక చర్య వలన ఏర్పడు బేరియం లవణం . ఆకుపచ్చ రంగు ఏర్పరచుటకై, కొన్ని సందర్భాలలో బాణసంచు (pyrotechnics) లో వాడెదరు .అలాగే క్లోరిక్ ఆమ్లాన్ని ఉత్పత్తి చెయ్యుటకై కూడావినియోగిస్తారు.

బేరియం క్లోరేట్ యొక్క రసాయన ఫార్ములా Ba (ClO3) 2. మోలార్ భారం 304.23 గ్రాములు/మోల్. సాంద్రత 3.18 గ్రాములు/సెం.మీ3.ద్రవీభవన స్థానం 413.9 °C (ఈ ఉష్ణోగ్రత వద్ద వియోగం చెందును). నీటిలో ద్రావణియత 27.5గ్రాములు/100 మి.లీ .నీటిలో (20°Cవద్ద).

రసాయన చర్యలు[మార్చు]


బేరియం క్లోరైడ్, సోడియం క్లోరేట్ ద్రావల మద్య డబుల్ రిప్లేస్ మెంట్ చర్య జరపడం వలన బేరియం క్లోరేట్ ఉత్పత్తి చెయ్యబడును.

BaCl2 + 2 NaClO3 → Ba(ClO3)2 + 2 NaCl

పై చర్య ఫలితంగా ఏర్పడిన ఫలితాంశచర్యా జనితాన్ని శీతలీకరించి, సాంద్రి కరణ చెందించిన బేరియం క్లోరేట్ అవక్షేపగా ఏర్పడును.నీటిలో సోడియం క్లోరేట్ కన్న బేరియం క్లోరేట్ తక్కువ ద్రావనియత స్వభావం కలిగి ఉండటం వలన, ఈ విధానంలో బేరియం క్లోరేట్ ను అవక్షేపిచి వేరుచేస్తారు. అయితే ఈ పద్ధతిలో ఉత్పత్తి చేసిన బేరియం క్లోరేట్ లో సోడియం మూలకం మలిన రూపంలో ఉంటుంది, ఈ కారణం వలన దీనిని నేరుగా బాణసంచు (pyrotechnic) గా వినియోగించిన, సోడియం వెలువరించు పసుపు రంగు వలన, బేరియం క్లోరేట్ వెలువరించు ఆకుపచ్చ వర్ణం వెల వెల పోవును.అందువలన పై విధానంలో ఉత్పత్తి చేసిన బేరియం క్లోరేట్ ను బాణసంచు/మందుగుండు సామాగ్రిలో ఉపయోగించరు.

సోడియం లేని /రహిత బేరియం క్లోరెట్ను విద్యుద్విశ్లేషణ విధానంద్వారా ఉత్పత్తి చెయ్యుదురు .

BaCl2 + 6 H2O → Ba(ClO3)2 + 6 H2

మరుగుచున్న అమ్మోనియం క్లోరేట్ ద్రావణంతో బేరియం కార్బోనేట్ ను చర్య జరిపించడం వలనకూడా బేరియం క్లోరేట్ ను ఉత్పత్తి చేయ్యుదురు[1].

2 NH4ClO3 + BaCO3 + Q → Ba(ClO3)2 + 2 NH3 + H2O + CO2

పై రసాయన చర్య వలనమొదట బేరియం క్లోరేట్, అమ్మోనియం కార్బోనేట్ ఏర్పడి, మరుగుచున్న అమ్మోనియం కార్బోనేట్ ద్రవాణం అమ్మోనియా, కార్బన్ డై ఆక్సైడ్ గావియోగంచెందటం వలన, ద్రావణంలో కేవలం బేరియం క్లోరేట్ మిగిలి ఉండును.


ఉష్ణానికి/వేడికి గురికావించిన బేరియం క్లోరేట్ బేరియం క్లోరైడ్, ఆక్సిజన్ గా వియోగం చెందును.

Ba(ClO3)2 → BaCl2 + 3O2

క్లోరిక్ ఆమ్లం[మార్చు]

బేరియం క్లోరేట్ సమ్మెళన పదార్థంనుండి క్లోరిక్ ఆమ్లాన్ని ఉత్పత్తి చెయ్యుదురు.బేరియం క్లోరెట్ను సజల సల్ఫ్యూరిక్ ఆమ్లంతో చర్య జరిపిం చడం వలన ద్రవ క్లోరిక్ ఆమ్లం, ద్రవంలో అవక్షేపంగా బేరియం సల్ఫేట్ ఏర్పడును.

Ba(ClO3)2 + H2SO4 → 2HClO3 + BaSO4

పై రసాయన చర్యలో ఉపయోగించు పదార్థాలను మొదట సజల ద్రవాలుగా చేసి, రసాయనిక చర్యను కొనసాగించటం వలన సజల క్లోరిక్ ఆమ్లఉత్పత్తిఅగును.గాఢత కలిగిన ద్రవరూపంలో ఉపయోగించిన, ఏర్పడు గాఢ క్లోరిక్ ఆమ్లం అస్థిర గుణం వలన వియోగం చెందును.కొన్నిసార్లు ప్రేలే అవకాశం ఉంది.


బాణసంచా (మందుగుండు) సమానులలో పచ్చ రంగు వెలుతురును వేలువరించుటకై బెరియం క్లోరేట్ ఉపయోగిస్తారు.అయితే దీనిని C శ్రేణికి చెందిన బాణసంచాలో వినియోగిం చుటను అమెరికా రాష్ట్రాలలో నిషేధించారు[2].

పరిసర ప్రభావం[మార్చు]

బేరియం క్లోరేట్ మనుషులపై విషప్రభావం కనపరచును[3][4].


  1. Perigrin, Tom. "Barium Chlorate". GeoCities. మూలం నుండి 2007-10-30 న ఆర్కైవు చేసారు. Retrieved 2007-02-22. Cite web requires |website= (help)
  2. Wilson, Elizabeth. "C&EN: SCIENCE & TECHNOLOGY - WHAT'S THAT STUFF? FIREWORKS." WHAT'S THAT STUFF? FIREWORKS. Chemical and Engineering News, 2 July 2001. Web. 28 Jan. 2013.
  3. http://www.inchem.org/documents/icsc/icsc/eics0613.htm
  4. http://nj.gov/health/eoh/rtkweb/documents/fs/0183.pdf