బెరీలియం నైట్రేట్

వికీపీడియా నుండి
Jump to navigation Jump to search
బెరీలియం నైట్రేట్
Beryllium Nitrate Diagram.svg
Systematic IUPAC name
Beryllium nitrate
ఇతర పేర్లు
Beryllium dinitrate
గుర్తింపు విషయాలు
సి.ఎ.ఎస్. సంఖ్య [13597-99-4]
పబ్ కెమ్ 26126
యూరోపియన్ కమిషన్ సంఖ్య 237-062-5
SMILES [Be+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O
మోలార్ ద్రవ్యరాశి 133.021982 g/mol
స్వరూపం white to yellow solid
వాసన odorless
సాంద్రత 1.56 g/cm3[1]
ద్రవీభవన స్థానం 60.5[1] °C (140.9 °F; 333.6 K)
బాష్పీభవన స్థానం 142 °C (288 °F; 415 K) (decomposes)
166 g/100 mL
ఉష్ణగతిక రసాయన శాస్త్రము
నిర్మాణము మారుటకు
కావాల్సిన ప్రామాణిక
-700.4 kJ/mol
US health exposure limits (NIOSH):
PEL (Permissible)
TWA 0.002 mg/m3
C 0.005 mg/m3 (30 minutes), with a maximum peak of 0.025 mg/m3 (as Be)
REL (Recommended)
Ca C 0.0005 mg/m3 (as Be)
IDLH (Immediate danger)
Ca [4 mg/m3 (as Be)]
సంబంధిత సమ్మేళనాలు
ఇతర కాటయాన్లు
Magnesium nitrate
Calcium nitrate
Strontium nitrate
Barium nitrate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☑Y verify (what is ☑Y☒N ?)
Infobox references

బెరిలీయం నైట్రేట్ ఒక అకర్బన రసాయన సమ్మేళనం. బెరిలీయం నైట్రేట్‌ను బెరిలీయం డైనైట్రేట్ అని కూడా పిలుస్తారు.ఈ రసాయన సంయోగ పదార్థం నైట్రిక్ ఆమ్లం యొక్క అయోనిక్ బెరిలీయం లవణం.ఈ సమ్మేళనపదార్థం రసాయన సంకేతపదం Be(NO3)2.ప్రతి ఫార్ములా యూనిట్లో ఒక Be2+ కెటాయాన్‌, రెండు NO3 అనయానులు ఉండును.

భౌతిక లక్షణాలు[మార్చు]

తెల్లగాలేదా పసుపు రంగులో ఉండు ఘనపదార్థం.బెరిలీయం నైట్రేట్ అణుభారం 133.021982 గ్రాములు/మోల్[1]. సాధారణ 25 °C ఉష్ణోగ్రత వద్ద బెరిలీయం నైట్రేట్ సాంద్రత 1.56గ్రాములు/సెం.మీ3.ఈ రసాయన సమ్మేళనపదార్థం ద్రవీభవన స్థానం 60.5 °C (140.9 °F; 333.6K).బెరిలీయం నైట్రేట్ బాష్పీభవన స్థానం 142 °C (288 °F; 415K),ఈ ఉష్ణోగ్రతవద్ద ఈ సంయోగపదార్థం వియోగం చెందును.నీటిలో కరుగుతుంది. గది ఉష్ణోగ్రత వద్ద 100 మి.లీ.నీటిలో 116 గ్రాముల బెరిలీయం నైట్రేట్ కరుగుతుంది.


నైట్రిక్ ఆమ్లంతో బెరిలీయం హైడ్రాక్సైడ్ రసాయనచర్య వలన బెరిలీయం నైట్రేట్ ఏర్పడును[2].

Be(OH)2 + 2 HNO3 → Be(NO3)2 + 2 H2O


మిగతా బెరిలీయం సంయోగపదార్థాల వలె బెరిలీయం నైట్రేట్ కుడా విషస్వభావమున్న రసాయనం[1] . తక్కువ మోతాదులో చికాకుకలిగించే ప్రేరణ గుణం కలిగిఉన్నది.దీనిని మండించినపుడు ఇరిటేసన్ కల్గించే ఆవిరులను/పొగలను వెలువరిస్తుంది.

ఇవికూడా చూడండి[మార్చు]


  1. 1.0 1.1 1.2 1.3 "BERYLLIUM NITRATE". inchem.org. http://www.inchem.org/documents/icsc/icsc/eics1352.htm. Retrieved 2015-10-06. 
  2. Walsh, Kenneth (2009). Beryllium chemistry and processing. ASM International. pp. 121–122. ISBN 978-0-87170-721-5. Retrieved 3 January 2011.