మిరిస్టోలిక్ ఆమ్లం

వికీపీడియా నుండి
Jump to navigation Jump to search
మిరిస్టోలిక్ ఆమ్లం
Myristoleic acid.png
IUPAC నామము
(Z)-Tetradec-9-enoic acid
ఇతర పేర్లు
9-Tetradecenoic acid
9-cis-Tetradecenoic acid
cis9-Tetradecenoic acid
Myristolenic acid
Oleomyristic acid
గుర్తింపు విషయాలు
సి.ఎ.ఎస్. సంఖ్య [544-64-9]
పబ్ కెమ్ 5281119
  • InChI=1/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/b6-5-

మోలార్ ద్రవ్యరాశి 226.36 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)
Infobox references

మిరిస్టోలిక్ ఆమ్లం ఒక కొవ్వు ఆమ్లం. ఇది ఒక అసంతృప్త కొవ్వు ఆమ్లం. ఏకద్విబంధమున్న కొవ్వుఆమ్లం. కొవ్వుఆమ్లాలలోని కార్బనులు, హైడ్రోజన్ పరమాణువులు గొలుసు లా ఒకదానొకటి అనుసంధానింపబడి, ఒక చివర కార్బోక్సిల్ (COOH) సమూహాన్నికలిగివుండటం వలన వీటిని కార్బోక్సిలిక్ ఆమ్లాలని అంటారు. ఆమ్లం ఒక కార్బోక్సిల్ సమూహాన్ని మాత్రమే కలిగి వుండటం వలన కొవ్వుఆమ్లాలను మోనోకార్బోక్సిలిక్ ఆమ్లాలని ఆంటారు. మిరిస్టోలిక్ ఆమ్లం, మిరిస్టిక్ ఆమ్లం వలె 14 కార్బన్‌లనుకలిగివుండి, ఒకద్విబంధం వున్న కారణంచే మిరిస్టిక్ ఆమ్లం కన్న రెండు హైడ్రోజన్ పరమాణువులను తక్కువ కలిగివున్నది.

ఆమ్లం అణు సౌష్టవ నిర్మాణం-గుణగణాలు[మార్చు]

మిరిస్టోలిక్ 14 కార్బనులను కలిగివుండి,9 వ కార్బనువద్ద ద్విబంధాన్నికలిగివున్న ఒక అసంతృప్త కొవ్వుఆమ్లం. మిరిస్టేసియే కుటుంబానికి చెందిన మొక్కలగింజల నూనెలో మిరిస్టిక్ ఆమ్లం అధికంలో వుండటం వలన మిరిస్టిక్ అనేపేరు ఈ ఆమ్లాలకు ముందు పేరుగా స్థిరపడినది. మిరిస్టోలిక్ ఆమ్లం అనేపేరు వాడుక పేరు. శాస్త్రీయంగా చాలారకాలుగా పిలుస్తారు. మాములుగా పిలిచే పేరు సిస్, 9-టెట్రాడెసెనోయిక్ ఆసిడ్ (9Z) -9-Tetradecenoic acid). దీనిని ఒమేగా (ω) -5 కొవ్వు ఆమ్లమనికూడా అంటారు. క్లుప్తంగా 14:1n-5 అనికూడా అనేదరు. అనగా 14 కార్బనులు ఉన్నాయి. ఒకద్విబంధమున్నది, అది 5 వ కార్బనువద్ద (మిథైల్ (CH3) సమూహంనుండి కార్బనులను లెక్కించన) ద్విబంధము కలిగి వున్నదని తెలుపుచున్నది.

మిరిస్టోలిక్ ఆమ్లం ఇతర పేర్లు (ఆంగ్లంలో)

  1. (9Z) -9-tetradecenoic acid [ACD/IUPAC Name]
  2. (9Z) -9-Tetradecensäure [German] [ACD/IUPAC Name]
  3. (9Z) -Tetradec-9-enoic acid
  4. (9Z) -Tetradecenoic acid
  5. 9-tetradecenoic acid, (9Z) - [ACD/Index Name]
  6. 9-Tetradecenoic acid, (Z) -
  7. 9Z-tetradecenoic acid
  8. Acide (9Z) -9-tétradécénoïque [French] [ACD/IUPAC Name]
  9. cis-δ (9) -tetradecenoic acid

మిరిస్టోలిక్ ఆమ్లం భౌతిక రసాయనిక ధర్మాలు [1]

గుణము విలువల మితి
ఆణు సూత్రం CH3 (CH2) 3CH=CH (CH2) 7COOH
ఆణుభారం 226.36
వక్రీభవన సూచిక 1.4562
సాంద్రత,25°Cవద్ద .9 గ్రాం/మి.లీ
బాష్పీభవన ఉష్ణోగ్రత 144 °C/0.6 mmHg (lit.)
ద్రవీభవన ఉష్ణోగ్రత −4.5 to −4 °C
తలతన్యత 33.9±3.0 dyne/cm[2]
బాష్పీభవన ఉష్ణోగ్రత
వాతావరణ పీడనం వద్ద
ఫ్లాష్ పాయింట్ 206.5±14.4°C[2]

లభ్యత :ఈ అసంతృప కొవ్వు ఆమ్లం జంతు కొవ్వులలో లభిస్తుంది. జలచరజీవులైన వేల్ బ్లుబ్బర్ (whale blubber), సొరచేప కాలేయం, ఈల్ (Eel), తాబేలు లనూనెలలో ఉంది. అలాగే పాలకొవ్వువెన్నలో కూడా ఈ ఆమ్ల ఉనికిని గుర్తించారు. [3]

ఉత్పత్తులు :

  • ఆల్కహాల్ లతో చర్య జరిపించిన కొవ్వు ఆమ్లంయొక్క ఎస్టరులు ఏర్పడును.మిరిస్టోలిక్ ఆమ్లంయొక్క మిథైల్ ఆల్కహాల్ ఎస్టరును సిస్,9-టెట్రాడెసెనోయిల్ ఆసిడ్ మిథైల్ ఎస్టరు (cis-9-tetradecenoic acid methyl ester) అంటారు. ఎస్టరు యొక్క IUCPC పేరు: methyl (Z) -tetradec-9-enoate.దీని అణుభారం:240.39, అణు సూత్రం:C15H28O2
  • క్షారాలతో చర్యవలన సబ్బులు ఏర్పడును.
  • సంపూర్ణ ఉదజణీకరణ చెయ్యడం వలన మిరిస్టిక్ ఆమ్లం ఉత్పత్తి అగును.


  • సబ్బుల తయారిలో ఉపయోగించవచ్చును.
  • మిథైల్, ఇదైల్ ఎస్టరులను బయోడిసెల్ గా ఉపయోగించవచ్చును.
  • ఉదజణీకరణ చేసి మిరిస్టిక్ ఆమ్లాన్ని తయారుచెయ్యవచ్చును.
  • కొన్ని రకాల ఎంజైమ్ల (cytochrome P450 enzyme CYP102D1) తయారు చేయుదురు.

ఇవికుడా చూడండి[మార్చు]

బయటి లింకులు[మార్చు]

  1. http://www.chemspider.com/Chemical-Structure.4444564.html


  1. "Myristoleic acid". www.sigmaaldrich.com/. Retrieved 2013-11-30.
  2. 2.0 2.1 2.2 "Myristoleic acid". http://www.chemspider.com/. Retrieved 2013-11-30. {{cite web}}: External link in |publisher= (help)
  3. "Myristoleic acid". www.tuscany-diet.net/. Retrieved 2013-11-30.